C23H15F3N4O4 — CID 66507069
3-(4-methoxyphenyl)-5-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66507069) has the molecular formula C23H15F3N4O4 and a molecular weight of 468.39 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 3-(4-methoxyphenyl)-5-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66507069 |
| Molecular Formula | C23H15F3N4O4 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | COc1ccc(-c2nn(C)c3ncc4c(c23)C(=O)N(c2cccc(OC(F)(F)F)c2)C4=O)cc1 |
| InChI | InChI=1S/C23H15F3N4O4/c1-29-20-18(19(28-29)12-6-8-14(33-2)9-7-12)17-16(11-27-20)21(31)30(22(17)32)13-4-3-5-15(10-13)34-23(24,25)26/h3-11H,1-2H3 |
| InChIKey | JEYWXYORTUXUDM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|