C20H15F3N4O5S — CID 66506373
5-(1,1-dioxothiolan-3-yl)-3-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66506373) has the molecular formula C20H15F3N4O5S and a molecular weight of 480.42 g/mol. Its IUPAC name is 5-(1,1-dioxothiolan-3-yl)-3-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 5-(1,1-dioxothiolan-3-yl)-3-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506373 |
| Molecular Formula | C20H15F3N4O5S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 5-(1,1-dioxothiolan-3-yl)-3-methyl-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | Cc1nn(C2CCS(=O)(=O)C2)c2ncc3c(c12)C(=O)N(c1cccc(OC(F)(F)F)c1)C3=O |
| InChI | InChI=1S/C20H15F3N4O5S/c1-10-15-16-14(8-24-17(15)27(25-10)12-5-6-33(30,31)9-12)18(28)26(19(16)29)11-3-2-4-13(7-11)32-20(21,22)23/h2-4,7-8,12H,5-6,9H2,1H3 |
| InChIKey | MRLNGAMYBLQMFH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|