C21H10ClF3N4O3 — CID 66506895
3-(4-chlorophenyl)-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 66506895) has the molecular formula C21H10ClF3N4O3 and a molecular weight of 458.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 3-(4-chlorophenyl)-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506895 |
| Molecular Formula | C21H10ClF3N4O3 |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 3-(4-chlorophenyl)-11-[3-(trifluoromethoxy)phenyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | O=C1c2cnc3n[nH]c(-c4ccc(Cl)cc4)c3c2C(=O)N1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H10ClF3N4O3/c22-11-6-4-10(5-7-11)17-16-15-14(9-26-18(16)28-27-17)19(30)29(20(15)31)12-2-1-3-13(8-12)32-21(23,24)25/h1-9H,(H,26,27,28) |
| InChIKey | JEUXYWUULNZBCS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|