C24H15FN4O6 — CID 66506741
dimethyl 5-[3-(4-fluorophenyl)-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-11-yl]benzene-1,3-dicarboxylate (PubChem CID 66506741) has the molecular formula C24H15FN4O6 and a molecular weight of 474.40 g/mol. Its IUPAC name is dimethyl 5-[3-(4-fluorophenyl)-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-11-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-(4-fluorophenyl)-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-11-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66506741 |
| Molecular Formula | C24H15FN4O6 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | dimethyl 5-[3-(4-fluorophenyl)-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-11-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(N2C(=O)c3cnc4n[nH]c(-c5ccc(F)cc5)c4c3C2=O)c1 |
| InChI | InChI=1S/C24H15FN4O6/c1-34-23(32)12-7-13(24(33)35-2)9-15(8-12)29-21(30)16-10-26-20-18(17(16)22(29)31)19(27-28-20)11-3-5-14(25)6-4-11/h3-10H,1-2H3,(H,26,27,28) |
| InChIKey | LHSVBKSSRWLANP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|