C25H16F2N4O6 — CID 66506292
dimethyl 5-[5-(2,4-difluorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]benzene-1,3-dicarboxylate (PubChem CID 66506292) has the molecular formula C25H16F2N4O6 and a molecular weight of 506.42 g/mol. Its IUPAC name is dimethyl 5-[5-(2,4-difluorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[5-(2,4-difluorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66506292 |
| Molecular Formula | C25H16F2N4O6 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | dimethyl 5-[5-(2,4-difluorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(N2C(=O)c3cnc4c(c(C)nn4-c4ccc(F)cc4F)c3C2=O)c1 |
| InChI | InChI=1S/C25H16F2N4O6/c1-11-19-20-16(10-28-21(19)31(29-11)18-5-4-14(26)9-17(18)27)22(32)30(23(20)33)15-7-12(24(34)36-2)6-13(8-15)25(35)37-3/h4-10H,1-3H3 |
| InChIKey | NQAHVYHUOKVHJK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|