C22H14F2N4O2 — CID 66507961
11-(2-fluoro-4-methylphenyl)-5-(4-fluorophenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66507961) has the molecular formula C22H14F2N4O2 and a molecular weight of 404.38 g/mol. Its IUPAC name is 11-(2-fluoro-4-methylphenyl)-5-(4-fluorophenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-(2-fluoro-4-methylphenyl)-5-(4-fluorophenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66507961 |
| Molecular Formula | C22H14F2N4O2 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 11-(2-fluoro-4-methylphenyl)-5-(4-fluorophenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | Cc1ccc(N2C(=O)c3cnc4c(c(C)nn4-c4ccc(F)cc4)c3C2=O)c(F)c1 |
| InChI | InChI=1S/C22H14F2N4O2/c1-11-3-8-17(16(24)9-11)27-21(29)15-10-25-20-18(19(15)22(27)30)12(2)26-28(20)14-6-4-13(23)5-7-14/h3-10H,1-2H3 |
| InChIKey | LLMBFAYPIVUNAP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|