C20H13N5O3 — CID 66506712
11-(2-methoxyphenyl)-3-pyridin-4-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 66506712) has the molecular formula C20H13N5O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is 11-(2-methoxyphenyl)-3-pyridin-4-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 11-(2-methoxyphenyl)-3-pyridin-4-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506712 |
| Molecular Formula | C20H13N5O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 11-(2-methoxyphenyl)-3-pyridin-4-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | COc1ccccc1N1C(=O)c2cnc3n[nH]c(-c4ccncc4)c3c2C1=O |
| InChI | InChI=1S/C20H13N5O3/c1-28-14-5-3-2-4-13(14)25-19(26)12-10-22-18-16(15(12)20(25)27)17(23-24-18)11-6-8-21-9-7-11/h2-10H,1H3,(H,22,23,24) |
| InChIKey | ZXLLFZSKWBPBTF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|