C16H12N4O3 — CID 66506443
11-(4-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 66506443) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 11-(4-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506443 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 11-(4-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | COc1ccc(N2C(=O)c3cnc4n[nH]c(C)c4c3C2=O)cc1 |
| InChI | InChI=1S/C16H12N4O3/c1-8-12-13-11(7-17-14(12)19-18-8)15(21)20(16(13)22)9-3-5-10(23-2)6-4-9/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | UIVGESBUYAYEJC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|