C20H10ClN5O4 — CID 66506608
3-(4-chlorophenyl)-11-(4-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 66506608) has the molecular formula C20H10ClN5O4 and a molecular weight of 419.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-11-(4-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 3-(4-chlorophenyl)-11-(4-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506608 |
| Molecular Formula | C20H10ClN5O4 |
| Molecular Weight | 419.78 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 3-(4-chlorophenyl)-11-(4-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | O=C1c2cnc3n[nH]c(-c4ccc(Cl)cc4)c3c2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H10ClN5O4/c21-11-3-1-10(2-4-11)17-16-15-14(9-22-18(16)24-23-17)19(27)25(20(15)28)12-5-7-13(8-6-12)26(29)30/h1-9H,(H,22,23,24) |
| InChIKey | AAKBRZOTJOKWSV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|