C22H17N5O5 — CID 66506934
3-pyridin-4-yl-11-(3,4,5-trimethoxyphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 66506934) has the molecular formula C22H17N5O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-pyridin-4-yl-11-(3,4,5-trimethoxyphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 3-pyridin-4-yl-11-(3,4,5-trimethoxyphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506934 |
| Molecular Formula | C22H17N5O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-pyridin-4-yl-11-(3,4,5-trimethoxyphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | COc1cc(N2C(=O)c3cnc4n[nH]c(-c5ccncc5)c4c3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H17N5O5/c1-30-14-8-12(9-15(31-2)19(14)32-3)27-21(28)13-10-24-20-17(16(13)22(27)29)18(25-26-20)11-4-6-23-7-5-11/h4-10H,1-3H3,(H,24,25,26) |
| InChIKey | GSQALMZLSZCELG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|