C21H17NO4S — CID 66507362
1-(5,5-dioxophenothiazin-10-yl)-2-(4-methoxyphenyl)ethanone (PubChem CID 66507362) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-(5,5-dioxophenothiazin-10-yl)-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-(5,5-dioxophenothiazin-10-yl)-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 66507362 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-(5,5-dioxophenothiazin-10-yl)-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2c3ccccc3S(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H17NO4S/c1-26-16-12-10-15(11-13-16)14-21(23)22-17-6-2-4-8-19(17)27(24,25)20-9-5-3-7-18(20)22/h2-13H,14H2,1H3 |
| InChIKey | GBVRWMSUUDSANX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |