C25H20N6O6S — CID 66507437
methyl 2-[[5-[8-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 66507437) has the molecular formula C25H20N6O6S and a molecular weight of 532.54 g/mol. Its IUPAC name is methyl 2-[[5-[8-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[8-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 66507437 |
| Molecular Formula | C25H20N6O6S |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | methyl 2-[[5-[8-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1n[nH]c(-n2ccc3nc4ccn(Cc5ccc6c(c5)OCCO6)c(=O)c4cc3c2=O)n1 |
| InChI | InChI=1S/C25H20N6O6S/c1-35-21(32)13-38-25-27-24(28-29-25)31-7-5-18-16(23(31)34)11-15-17(26-18)4-6-30(22(15)33)12-14-2-3-19-20(10-14)37-9-8-36-19/h2-7,10-11H,8-9,12-13H2,1H3,(H,27,28,29) |
| InChIKey | YKMBCYXFSUBJDS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|