C19H16N2O4S — CID 66507488
1-(5,5-dioxophenothiazin-10-yl)-2-(furan-2-ylmethylamino)ethanone (PubChem CID 66507488) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-(5,5-dioxophenothiazin-10-yl)-2-(furan-2-ylmethylamino)ethanone.
| Compound Name | 1-(5,5-dioxophenothiazin-10-yl)-2-(furan-2-ylmethylamino)ethanone |
|---|---|
| PubChem CID | 66507488 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(5,5-dioxophenothiazin-10-yl)-2-(furan-2-ylmethylamino)ethanone |
| SMILES | O=C(CNCc1ccco1)N1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H16N2O4S/c22-19(13-20-12-14-6-5-11-25-14)21-15-7-1-3-9-17(15)26(23,24)18-10-4-2-8-16(18)21/h1-11,20H,12-13H2 |
| InChIKey | GTUSMTZRDDNXCJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |