C30H30N4O2 — CID 66507852
ethyl 1,3-dibenzyl-2-cyanoimino-6-methyl-4-(4-methylphenyl)-4H-pyrimidine-5-carboxylate (PubChem CID 66507852) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is ethyl 1,3-dibenzyl-2-cyanoimino-6-methyl-4-(4-methylphenyl)-4H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 1,3-dibenzyl-2-cyanoimino-6-methyl-4-(4-methylphenyl)-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 66507852 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | ethyl 1,3-dibenzyl-2-cyanoimino-6-methyl-4-(4-methylphenyl)-4H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccccc2)/C(=N\C#N)N(Cc2ccccc2)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C30H30N4O2/c1-4-36-29(35)27-23(3)33(19-24-11-7-5-8-12-24)30(32-21-31)34(20-25-13-9-6-10-14-25)28(27)26-17-15-22(2)16-18-26/h5-18,28H,4,19-20H2,1-3H3/b32-30+ |
| InChIKey | SJALIEMLIOBOND-NHQGMKOOSA-N |
| XLogP | 5.73 |
| TPSA | 68.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|