C29H30N2O3S — CID 11190962
ethyl 1-benzyl-2-benzylsulfanyl-4-(4-methoxyphenyl)-6-methyl-4H-pyrimidine-5-carboxylate (PubChem CID 11190962) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is ethyl 1-benzyl-2-benzylsulfanyl-4-(4-methoxyphenyl)-6-methyl-4H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 1-benzyl-2-benzylsulfanyl-4-(4-methoxyphenyl)-6-methyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11190962 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | ethyl 1-benzyl-2-benzylsulfanyl-4-(4-methoxyphenyl)-6-methyl-4H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccccc2)C(SCc2ccccc2)=NC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H30N2O3S/c1-4-34-28(32)26-21(2)31(19-22-11-7-5-8-12-22)29(35-20-23-13-9-6-10-14-23)30-27(26)24-15-17-25(33-3)18-16-24/h5-18,27H,4,19-20H2,1-3H3 |
| InChIKey | KIVJZMQWRLAQRG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |