C17H20N2O3S — CID 6934700
ethyl (4S)-1-acetyl-6-methyl-2-methylsulfanyl-4-phenyl-4H-pyrimidine-5-carboxylate (PubChem CID 6934700) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is ethyl (4S)-1-acetyl-6-methyl-2-methylsulfanyl-4-phenyl-4H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-1-acetyl-6-methyl-2-methylsulfanyl-4-phenyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 6934700 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | ethyl (4S)-1-acetyl-6-methyl-2-methylsulfanyl-4-phenyl-4H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(C(C)=O)C(SC)=N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-5-22-16(21)14-11(2)19(12(3)20)17(23-4)18-15(14)13-9-7-6-8-10-13/h6-10,15H,5H2,1-4H3/t15-/m0/s1 |
| InChIKey | GENNDLFXLZYIDA-HNNXBMFYSA-N |
| XLogP | 3.15 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |