C20H26N2O3S — CID 27256057
ethyl (4R)-3-acetyl-2-butylsulfanyl-6-methyl-4-phenyl-4H-pyrimidine-5-carboxylate (PubChem CID 27256057) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is ethyl (4R)-3-acetyl-2-butylsulfanyl-6-methyl-4-phenyl-4H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-3-acetyl-2-butylsulfanyl-6-methyl-4-phenyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 27256057 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethyl (4R)-3-acetyl-2-butylsulfanyl-6-methyl-4-phenyl-4H-pyrimidine-5-carboxylate |
| SMILES | CCCCSC1=NC(C)=C(C(=O)OCC)[C@@H](c2ccccc2)N1C(C)=O |
| InChI | InChI=1S/C20H26N2O3S/c1-5-7-13-26-20-21-14(3)17(19(24)25-6-2)18(22(20)15(4)23)16-11-9-8-10-12-16/h8-12,18H,5-7,13H2,1-4H3/t18-/m1/s1 |
| InChIKey | ZXABNUQZRKGDFP-GOSISDBHSA-N |
| XLogP | 4.32 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|