C23H27N3O2 — CID 10691005
ethyl 2-amino-3-butyl-4,6-diphenyl-4H-pyrimidine-5-carboxylate (PubChem CID 10691005) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is ethyl 2-amino-3-butyl-4,6-diphenyl-4H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-amino-3-butyl-4,6-diphenyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10691005 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | ethyl 2-amino-3-butyl-4,6-diphenyl-4H-pyrimidine-5-carboxylate |
| SMILES | CCCCN1C(N)=NC(c2ccccc2)=C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2/c1-3-5-16-26-21(18-14-10-7-11-15-18)19(22(27)28-4-2)20(25-23(26)24)17-12-8-6-9-13-17/h6-15,21H,3-5,16H2,1-2H3,(H2,24,25) |
| InChIKey | KFYAETWLCIGNKK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |