C30H37N3O3S — CID 5010615
ethyl 6-[4-(octanoylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 5010615) has the molecular formula C30H37N3O3S and a molecular weight of 519.71 g/mol. Its IUPAC name is ethyl 6-[4-(octanoylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl 6-[4-(octanoylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 5010615 |
| Molecular Formula | C30H37N3O3S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | ethyl 6-[4-(octanoylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCCCCCCC(=O)Nc1ccc(C2C(C(=O)OCC)=C(c3ccccc3)N=C3SCCCN32)cc1 |
| InChI | InChI=1S/C30H37N3O3S/c1-3-5-6-7-11-15-25(34)31-24-18-16-23(17-19-24)28-26(29(35)36-4-2)27(22-13-9-8-10-14-22)32-30-33(28)20-12-21-37-30/h8-10,13-14,16-19,28H,3-7,11-12,15,20-21H2,1-2H3,(H,31,34) |
| InChIKey | XHAHNJURCFTPRZ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|