C25H24F3N3O3S — CID 92518321
ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 92518321) has the molecular formula C25H24F3N3O3S and a molecular weight of 503.55 g/mol. Its IUPAC name is ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 92518321 |
| Molecular Formula | C25H24F3N3O3S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2SCCCN2[C@@H]1c1ccc(NC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H24F3N3O3S/c1-3-34-23(33)20-15(2)29-24-31(13-4-14-35-24)21(20)16-7-11-19(12-8-16)30-22(32)17-5-9-18(10-6-17)25(26,27)28/h5-12,21H,3-4,13-14H2,1-2H3,(H,30,32)/t21-/m1/s1 |
| InChIKey | XKKUHACGJKZXDL-OAQYLSRUSA-N |
| XLogP | 5.64 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |