C28H34N4O3S — CID 3254434
6-[4-[(4-butoxybenzoyl)amino]phenyl]-N,N,8-trimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 3254434) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is 6-[4-[(4-butoxybenzoyl)amino]phenyl]-N,N,8-trimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[4-[(4-butoxybenzoyl)amino]phenyl]-N,N,8-trimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 3254434 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 6-[4-[(4-butoxybenzoyl)amino]phenyl]-N,N,8-trimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(C3C(C(=O)N(C)C)=C(C)N=C4SCCCN43)cc2)cc1 |
| InChI | InChI=1S/C28H34N4O3S/c1-5-6-17-35-23-14-10-21(11-15-23)26(33)30-22-12-8-20(9-13-22)25-24(27(34)31(3)4)19(2)29-28-32(25)16-7-18-36-28/h8-15,25H,5-7,16-18H2,1-4H3,(H,30,33) |
| InChIKey | ODBLLCJKXVYFEX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|