C30H30N4O4S — CID 4625144
6-[3-[(2-methoxybenzoyl)amino]phenyl]-N-(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4625144) has the molecular formula C30H30N4O4S and a molecular weight of 542.66 g/mol. Its IUPAC name is 6-[3-[(2-methoxybenzoyl)amino]phenyl]-N-(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[(2-methoxybenzoyl)amino]phenyl]-N-(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4625144 |
| Molecular Formula | C30H30N4O4S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 6-[3-[(2-methoxybenzoyl)amino]phenyl]-N-(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)N=C3SCCCN3C2c2cccc(NC(=O)c3ccccc3OC)c2)cc1 |
| InChI | InChI=1S/C30H30N4O4S/c1-19-26(29(36)32-21-12-14-23(37-2)15-13-21)27(34-16-7-17-39-30(34)31-19)20-8-6-9-22(18-20)33-28(35)24-10-4-5-11-25(24)38-3/h4-6,8-15,18,27H,7,16-17H2,1-3H3,(H,32,36)(H,33,35) |
| InChIKey | METLQNZOYKOLCP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |