C30H31N5O4S — CID 42663865
6-[3-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 42663865) has the molecular formula C30H31N5O4S and a molecular weight of 557.68 g/mol. Its IUPAC name is 6-[3-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 42663865 |
| Molecular Formula | C30H31N5O4S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 6-[3-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | COc1cc(NC(=O)Nc2cccc(C3C(C(=O)Nc4ccccc4)=C(C)N=C4SCCCN43)c2)cc(OC)c1 |
| InChI | InChI=1S/C30H31N5O4S/c1-19-26(28(36)32-21-10-5-4-6-11-21)27(35-13-8-14-40-30(35)31-19)20-9-7-12-22(15-20)33-29(37)34-23-16-24(38-2)18-25(17-23)39-3/h4-7,9-12,15-18,27H,8,13-14H2,1-3H3,(H,32,36)(H2,33,34,37) |
| InChIKey | XRVRLLXCHBDLLP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |