C29H29N5O2S — CID 5205543
8-methyl-6-[3-[(3-methylphenyl)carbamoylamino]phenyl]-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 5205543) has the molecular formula C29H29N5O2S and a molecular weight of 511.65 g/mol. Its IUPAC name is 8-methyl-6-[3-[(3-methylphenyl)carbamoylamino]phenyl]-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 8-methyl-6-[3-[(3-methylphenyl)carbamoylamino]phenyl]-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 5205543 |
| Molecular Formula | C29H29N5O2S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 8-methyl-6-[3-[(3-methylphenyl)carbamoylamino]phenyl]-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2cccc(NC(=O)Nc3cccc(C)c3)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C29H29N5O2S/c1-19-9-6-13-23(17-19)32-28(36)33-24-14-7-10-21(18-24)26-25(27(35)31-22-11-4-3-5-12-22)20(2)30-29-34(26)15-8-16-37-29/h3-7,9-14,17-18,26H,8,15-16H2,1-2H3,(H,31,35)(H2,32,33,36) |
| InChIKey | QMPHIMXTQIFOIV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |