C26H24N4O3S — CID 4196547
6-[3-(furan-2-carbonylamino)phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4196547) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is 6-[3-(furan-2-carbonylamino)phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-(furan-2-carbonylamino)phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4196547 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 6-[3-(furan-2-carbonylamino)phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2cccc(NC(=O)c3ccco3)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C26H24N4O3S/c1-17-22(25(32)28-19-9-3-2-4-10-19)23(30-13-7-15-34-26(30)27-17)18-8-5-11-20(16-18)29-24(31)21-12-6-14-33-21/h2-6,8-12,14,16,23H,7,13,15H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | RDZSQKJKSCMGOH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |