C29H27FN4O3S — CID 4066283
6-[3-[(3-fluorobenzoyl)amino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4066283) has the molecular formula C29H27FN4O3S and a molecular weight of 530.63 g/mol. Its IUPAC name is 6-[3-[(3-fluorobenzoyl)amino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[(3-fluorobenzoyl)amino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4066283 |
| Molecular Formula | C29H27FN4O3S |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 6-[3-[(3-fluorobenzoyl)amino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C29H27FN4O3S/c1-18-25(28(36)33-23-12-3-4-13-24(23)37-2)26(34-14-7-15-38-29(34)31-18)19-8-6-11-22(17-19)32-27(35)20-9-5-10-21(30)16-20/h3-6,8-13,16-17,26H,7,14-15H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | NYLNDTCVFBZDSI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |