C28H32N4O3S — CID 4248370
6-[3-(cyclopentanecarbonylamino)phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4248370) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is 6-[3-(cyclopentanecarbonylamino)phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-(cyclopentanecarbonylamino)phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4248370 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 6-[3-(cyclopentanecarbonylamino)phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C28H32N4O3S/c1-18-24(27(34)31-22-13-5-6-14-23(22)35-2)25(32-15-8-16-36-28(32)29-18)20-11-7-12-21(17-20)30-26(33)19-9-3-4-10-19/h5-7,11-14,17,19,25H,3-4,8-10,15-16H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | KCFHIKJAABPQSB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |