C30H31N5O3S — CID 4232180
N-(2-methoxyphenyl)-8-methyl-6-[3-[(4-methylphenyl)carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4232180) has the molecular formula C30H31N5O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-8-methyl-6-[3-[(4-methylphenyl)carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-8-methyl-6-[3-[(4-methylphenyl)carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4232180 |
| Molecular Formula | C30H31N5O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-(2-methoxyphenyl)-8-methyl-6-[3-[(4-methylphenyl)carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C30H31N5O3S/c1-19-12-14-22(15-13-19)32-29(37)33-23-9-6-8-21(18-23)27-26(20(2)31-30-35(27)16-7-17-39-30)28(36)34-24-10-4-5-11-25(24)38-3/h4-6,8-15,18,27H,7,16-17H2,1-3H3,(H,34,36)(H2,32,33,37) |
| InChIKey | RPVXYMYFRLNOOU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |