C25H27ClN4O4S — CID 3591971
2-methoxyethyl 6-[3-[(4-chlorophenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 3591971) has the molecular formula C25H27ClN4O4S and a molecular weight of 515.04 g/mol. Its IUPAC name is 2-methoxyethyl 6-[3-[(4-chlorophenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | 2-methoxyethyl 6-[3-[(4-chlorophenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 3591971 |
| Molecular Formula | C25H27ClN4O4S |
| Molecular Weight | 515.04 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-methoxyethyl 6-[3-[(4-chlorophenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H27ClN4O4S/c1-16-21(23(31)34-13-12-33-2)22(30-11-4-14-35-25(30)27-16)17-5-3-6-20(15-17)29-24(32)28-19-9-7-18(26)8-10-19/h3,5-10,15,22H,4,11-14H2,1-2H3,(H2,28,29,32) |
| InChIKey | BVLJJWMFBMULIA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.04 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|