C24H32N4O3S — CID 92518415
ethyl (6R)-6-[3-(cyclohexylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 92518415) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is ethyl (6R)-6-[3-(cyclohexylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl (6R)-6-[3-(cyclohexylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 92518415 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | ethyl (6R)-6-[3-(cyclohexylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2SCCCN2[C@@H]1c1cccc(NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C24H32N4O3S/c1-3-31-22(29)20-16(2)25-24-28(13-8-14-32-24)21(20)17-9-7-12-19(15-17)27-23(30)26-18-10-5-4-6-11-18/h7,9,12,15,18,21H,3-6,8,10-11,13-14H2,1-2H3,(H2,26,27,30)/t21-/m1/s1 |
| InChIKey | PBNBFZHSDHMTAK-OAQYLSRUSA-N |
| XLogP | 4.83 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |