C21H28N4O3S — CID 7252115
propan-2-yl (6S)-6-[3-(dimethylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 7252115) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is propan-2-yl (6S)-6-[3-(dimethylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | propan-2-yl (6S)-6-[3-(dimethylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 7252115 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | propan-2-yl (6S)-6-[3-(dimethylcarbamoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)N(C)C)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C21H28N4O3S/c1-13(2)28-19(26)17-14(3)22-21-25(10-7-11-29-21)18(17)15-8-6-9-16(12-15)23-20(27)24(4)5/h6,8-9,12-13,18H,7,10-11H2,1-5H3,(H,23,27)/t18-/m0/s1 |
| InChIKey | GODFMXGCPUJKQC-SFHVURJKSA-N |
| XLogP | 3.86 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |