C23H23ClN4O2S — CID 42768290
6-[3-[(4-chlorobenzoyl)amino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 42768290) has the molecular formula C23H23ClN4O2S and a molecular weight of 454.98 g/mol. Its IUPAC name is 6-[3-[(4-chlorobenzoyl)amino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[(4-chlorobenzoyl)amino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 42768290 |
| Molecular Formula | C23H23ClN4O2S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 6-[3-[(4-chlorobenzoyl)amino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CNC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H23ClN4O2S/c1-14-19(22(30)25-2)20(28-11-4-12-31-23(28)26-14)16-5-3-6-18(13-16)27-21(29)15-7-9-17(24)10-8-15/h3,5-10,13,20H,4,11-12H2,1-2H3,(H,25,30)(H,27,29) |
| InChIKey | CRNUXHNKMLTOEV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |