C30H24F6N4O2S — CID 5071627
6-[3-[[3,5-bis(trifluoromethyl)benzoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 5071627) has the molecular formula C30H24F6N4O2S and a molecular weight of 618.60 g/mol. Its IUPAC name is 6-[3-[[3,5-bis(trifluoromethyl)benzoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[[3,5-bis(trifluoromethyl)benzoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 5071627 |
| Molecular Formula | C30H24F6N4O2S |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | 6-[3-[[3,5-bis(trifluoromethyl)benzoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2cccc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C30H24F6N4O2S/c1-17-24(27(42)38-22-8-3-2-4-9-22)25(40-11-6-12-43-28(40)37-17)18-7-5-10-23(15-18)39-26(41)19-13-20(29(31,32)33)16-21(14-19)30(34,35)36/h2-5,7-10,13-16,25H,6,11-12H2,1H3,(H,38,42)(H,39,41) |
| InChIKey | UKYLEYXHRYCHAC-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |