C28H27N3O3S — CID 4111968
ethyl 8-methyl-6-[3-(naphthalene-2-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 4111968) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is ethyl 8-methyl-6-[3-(naphthalene-2-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl 8-methyl-6-[3-(naphthalene-2-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 4111968 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | ethyl 8-methyl-6-[3-(naphthalene-2-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C28H27N3O3S/c1-3-34-27(33)24-18(2)29-28-31(14-7-15-35-28)25(24)21-10-6-11-23(17-21)30-26(32)22-13-12-19-8-4-5-9-20(19)16-22/h4-6,8-13,16-17,25H,3,7,14-15H2,1-2H3,(H,30,32) |
| InChIKey | VVLKGKDGDWNTHA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |