C32H33N3O3S — CID 3328353
2-methylpropyl 8-methyl-6-[3-[(4-phenylbenzoyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 3328353) has the molecular formula C32H33N3O3S and a molecular weight of 539.70 g/mol. Its IUPAC name is 2-methylpropyl 8-methyl-6-[3-[(4-phenylbenzoyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | 2-methylpropyl 8-methyl-6-[3-[(4-phenylbenzoyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 3328353 |
| Molecular Formula | C32H33N3O3S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-methylpropyl 8-methyl-6-[3-[(4-phenylbenzoyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CC1=C(C(=O)OCC(C)C)C(c2cccc(NC(=O)c3ccc(-c4ccccc4)cc3)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C32H33N3O3S/c1-21(2)20-38-31(37)28-22(3)33-32-35(17-8-18-39-32)29(28)26-11-7-12-27(19-26)34-30(36)25-15-13-24(14-16-25)23-9-5-4-6-10-23/h4-7,9-16,19,21,29H,8,17-18,20H2,1-3H3,(H,34,36) |
| InChIKey | FMEWXPQTCOLCRI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |