C26H27ClN4O5S — CID 3344285
2-methylpropyl 6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 3344285) has the molecular formula C26H27ClN4O5S and a molecular weight of 543.05 g/mol. Its IUPAC name is 2-methylpropyl 6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | 2-methylpropyl 6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 3344285 |
| Molecular Formula | C26H27ClN4O5S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 2-methylpropyl 6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CC1=C(C(=O)OCC(C)C)C(c2cccc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C26H27ClN4O5S/c1-15(2)14-36-25(33)22-16(3)28-26-30(10-5-11-37-26)23(22)17-6-4-7-19(12-17)29-24(32)18-8-9-20(27)21(13-18)31(34)35/h4,6-9,12-13,15,23H,5,10-11,14H2,1-3H3,(H,29,32) |
| InChIKey | LEJDQBFPSPBDTM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|