C32H34N4O2S — CID 5048222
6-[3-[(4-butylbenzoyl)amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 5048222) has the molecular formula C32H34N4O2S and a molecular weight of 538.72 g/mol. Its IUPAC name is 6-[3-[(4-butylbenzoyl)amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[(4-butylbenzoyl)amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 5048222 |
| Molecular Formula | C32H34N4O2S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 6-[3-[(4-butylbenzoyl)amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CCCCc1ccc(C(=O)Nc2cccc(C3C(C(=O)Nc4ccccc4)=C(C)N=C4SCCCN43)c2)cc1 |
| InChI | InChI=1S/C32H34N4O2S/c1-3-4-10-23-15-17-24(18-16-23)30(37)35-27-14-8-11-25(21-27)29-28(31(38)34-26-12-6-5-7-13-26)22(2)33-32-36(29)19-9-20-39-32/h5-8,11-18,21,29H,3-4,9-10,19-20H2,1-2H3,(H,34,38)(H,35,37) |
| InChIKey | DXSBFIHISGCYTI-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |