C29H36N4O2S — CID 93107893
(6R)-6-[4-[[(2R)-2-ethylhexanoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 93107893) has the molecular formula C29H36N4O2S and a molecular weight of 504.70 g/mol. Its IUPAC name is (6R)-6-[4-[[(2R)-2-ethylhexanoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | (6R)-6-[4-[[(2R)-2-ethylhexanoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 93107893 |
| Molecular Formula | C29H36N4O2S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | (6R)-6-[4-[[(2R)-2-ethylhexanoyl]amino]phenyl]-8-methyl-N-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CCCC[C@@H](CC)C(=O)Nc1ccc([C@@H]2C(C(=O)Nc3ccccc3)=C(C)N=C3SCCCN32)cc1 |
| InChI | InChI=1S/C29H36N4O2S/c1-4-6-11-21(5-2)27(34)31-24-16-14-22(15-17-24)26-25(28(35)32-23-12-8-7-9-13-23)20(3)30-29-33(26)18-10-19-36-29/h7-9,12-17,21,26H,4-6,10-11,18-19H2,1-3H3,(H,31,34)(H,32,35)/t21-,26-/m1/s1 |
| InChIKey | ZWZMNIRRUCCZDQ-QFQXNSOFSA-N |
| XLogP | 6.60 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |