C26H29N5O4S — CID 93107906
ethyl 2-[[4-[(6R)-8-methyl-7-(phenylcarbamoyl)-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazin-6-yl]phenyl]carbamoylamino]acetate (PubChem CID 93107906) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is ethyl 2-[[4-[(6R)-8-methyl-7-(phenylcarbamoyl)-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazin-6-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(6R)-8-methyl-7-(phenylcarbamoyl)-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazin-6-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 93107906 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | ethyl 2-[[4-[(6R)-8-methyl-7-(phenylcarbamoyl)-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazin-6-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@@H]2C(C(=O)Nc3ccccc3)=C(C)N=C3SCCCN32)cc1 |
| InChI | InChI=1S/C26H29N5O4S/c1-3-35-21(32)16-27-25(34)30-20-12-10-18(11-13-20)23-22(24(33)29-19-8-5-4-6-9-19)17(2)28-26-31(23)14-7-15-36-26/h4-6,8-13,23H,3,7,14-16H2,1-2H3,(H,29,33)(H2,27,30,34)/t23-/m1/s1 |
| InChIKey | IJHAMBPZNYCXML-HSZRJFAPSA-N |
| XLogP | 4.13 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |