C25H25F3N4O3S — CID 93045876
ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 93045876) has the molecular formula C25H25F3N4O3S and a molecular weight of 518.56 g/mol. Its IUPAC name is ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 93045876 |
| Molecular Formula | C25H25F3N4O3S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | ethyl (6R)-8-methyl-6-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2SCCCN2[C@@H]1c1ccc(NC(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H25F3N4O3S/c1-3-35-22(33)20-15(2)29-24-32(13-4-14-36-24)21(20)16-5-9-18(10-6-16)30-23(34)31-19-11-7-17(8-12-19)25(26,27)28/h5-12,21H,3-4,13-14H2,1-2H3,(H2,30,31,34)/t21-/m1/s1 |
| InChIKey | ZMLGAYFUCDIALG-OAQYLSRUSA-N |
| XLogP | 6.04 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |