C25H28N4O3S — CID 3600761
methyl 6-[4-[(2,6-dimethylphenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 3600761) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is methyl 6-[4-[(2,6-dimethylphenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | methyl 6-[4-[(2,6-dimethylphenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 3600761 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | methyl 6-[4-[(2,6-dimethylphenyl)carbamoylamino]phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | COC(=O)C1=C(C)N=C2SCCCN2C1c1ccc(NC(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C25H28N4O3S/c1-15-7-5-8-16(2)21(15)28-24(31)27-19-11-9-18(10-12-19)22-20(23(30)32-4)17(3)26-25-29(22)13-6-14-33-25/h5,7-12,22H,6,13-14H2,1-4H3,(H2,27,28,31) |
| InChIKey | IZSXFUKXKAERLN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |