C23H31N3O3S — CID 7356357
propan-2-yl (6S)-6-[4-(2,2-dimethylpropanoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 7356357) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is propan-2-yl (6S)-6-[4-(2,2-dimethylpropanoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | propan-2-yl (6S)-6-[4-(2,2-dimethylpropanoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 7356357 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | propan-2-yl (6S)-6-[4-(2,2-dimethylpropanoylamino)phenyl]-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)[C@H](c2ccc(NC(=O)C(C)(C)C)cc2)N2CCCSC2=N1 |
| InChI | InChI=1S/C23H31N3O3S/c1-14(2)29-20(27)18-15(3)24-22-26(12-7-13-30-22)19(18)16-8-10-17(11-9-16)25-21(28)23(4,5)6/h8-11,14,19H,7,12-13H2,1-6H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | WPMRJBABXXBHTG-IBGZPJMESA-N |
| XLogP | 4.75 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |