C28H35N5O3S — CID 42768299
6-[4-[(4-ethoxyphenyl)carbamoylamino]phenyl]-N,N-diethyl-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 42768299) has the molecular formula C28H35N5O3S and a molecular weight of 521.69 g/mol. Its IUPAC name is 6-[4-[(4-ethoxyphenyl)carbamoylamino]phenyl]-N,N-diethyl-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[4-[(4-ethoxyphenyl)carbamoylamino]phenyl]-N,N-diethyl-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 42768299 |
| Molecular Formula | C28H35N5O3S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 6-[4-[(4-ethoxyphenyl)carbamoylamino]phenyl]-N,N-diethyl-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(C3C(C(=O)N(CC)CC)=C(C)N=C4SCCCN43)cc2)cc1 |
| InChI | InChI=1S/C28H35N5O3S/c1-5-32(6-2)26(34)24-19(4)29-28-33(17-8-18-37-28)25(24)20-9-11-21(12-10-20)30-27(35)31-22-13-15-23(16-14-22)36-7-3/h9-16,25H,5-8,17-18H2,1-4H3,(H2,30,31,35) |
| InChIKey | CRAZSEVGZCJOBY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |