C29H32N4O3S2 — CID 4135725
N,N-diethyl-8-methyl-6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4135725) has the molecular formula C29H32N4O3S2 and a molecular weight of 548.73 g/mol. Its IUPAC name is N,N-diethyl-8-methyl-6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | N,N-diethyl-8-methyl-6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4135725 |
| Molecular Formula | C29H32N4O3S2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N,N-diethyl-8-methyl-6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NS(=O)(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C29H32N4O3S2/c1-4-32(5-2)28(34)26-20(3)30-29-33(17-10-18-37-29)27(26)22-13-8-14-23(19-22)31-38(35,36)25-16-9-12-21-11-6-7-15-24(21)25/h6-9,11-16,19,27,31H,4-5,10,17-18H2,1-3H3 |
| InChIKey | KTQAABJBPLCBNR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |