C29H36N4O2S — CID 4179851
N,N-diethyl-8-methyl-6-[3-(2-phenylbutanoylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4179851) has the molecular formula C29H36N4O2S and a molecular weight of 504.70 g/mol. Its IUPAC name is N,N-diethyl-8-methyl-6-[3-(2-phenylbutanoylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | N,N-diethyl-8-methyl-6-[3-(2-phenylbutanoylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4179851 |
| Molecular Formula | C29H36N4O2S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | N,N-diethyl-8-methyl-6-[3-(2-phenylbutanoylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CCC(C(=O)Nc1cccc(C2C(C(=O)N(CC)CC)=C(C)N=C3SCCCN32)c1)c1ccccc1 |
| InChI | InChI=1S/C29H36N4O2S/c1-5-24(21-13-9-8-10-14-21)27(34)31-23-16-11-15-22(19-23)26-25(28(35)32(6-2)7-3)20(4)30-29-33(26)17-12-18-36-29/h8-11,13-16,19,24,26H,5-7,12,17-18H2,1-4H3,(H,31,34) |
| InChIKey | AVJLKLQQCVQKGN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |