C27H28N4O3S2 — CID 4132726
N,N,8-trimethyl-6-[3-(naphthalen-2-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4132726) has the molecular formula C27H28N4O3S2 and a molecular weight of 520.68 g/mol. Its IUPAC name is N,N,8-trimethyl-6-[3-(naphthalen-2-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | N,N,8-trimethyl-6-[3-(naphthalen-2-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4132726 |
| Molecular Formula | C27H28N4O3S2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | N,N,8-trimethyl-6-[3-(naphthalen-2-ylsulfonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CC1=C(C(=O)N(C)C)C(c2cccc(NS(=O)(=O)c3ccc4ccccc4c3)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C27H28N4O3S2/c1-18-24(26(32)30(2)3)25(31-14-7-15-35-27(31)28-18)21-10-6-11-22(16-21)29-36(33,34)23-13-12-19-8-4-5-9-20(19)17-23/h4-6,8-13,16-17,25,29H,7,14-15H2,1-3H3 |
| InChIKey | DXOWPPMTPRBCLW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |