C24H27N3O4S2 — CID 42768333
methyl 8-ethyl-6-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 42768333) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is methyl 8-ethyl-6-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | methyl 8-ethyl-6-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 42768333 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | methyl 8-ethyl-6-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCC1=C(C(=O)OC)C(c2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)N2CCCSC2=N1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-4-20-21(23(28)31-3)22(27-13-6-14-32-24(27)25-20)17-7-5-8-18(15-17)26-33(29,30)19-11-9-16(2)10-12-19/h5,7-12,15,22,26H,4,6,13-14H2,1-3H3 |
| InChIKey | ASBDMCRZLNYITQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |