C25H30N4O3S2 — CID 42768339
N,8-dimethyl-6-[3-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 42768339) has the molecular formula C25H30N4O3S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is N,8-dimethyl-6-[3-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | N,8-dimethyl-6-[3-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 42768339 |
| Molecular Formula | C25H30N4O3S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N,8-dimethyl-6-[3-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CNC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NS(=O)(=O)c2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C25H30N4O3S2/c1-15-12-16(2)23(17(3)13-15)34(31,32)28-20-9-6-8-19(14-20)22-21(24(30)26-5)18(4)27-25-29(22)10-7-11-33-25/h6,8-9,12-14,22,28H,7,10-11H2,1-5H3,(H,26,30) |
| InChIKey | MWCBBHFJYKQOIO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |