C24H24N6O2S — CID 4258352
6-[3-[(4-cyanophenyl)carbamoylamino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4258352) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is 6-[3-[(4-cyanophenyl)carbamoylamino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[(4-cyanophenyl)carbamoylamino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4258352 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 6-[3-[(4-cyanophenyl)carbamoylamino]phenyl]-N,8-dimethyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CNC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C24H24N6O2S/c1-15-20(22(31)26-2)21(30-11-4-12-33-24(30)27-15)17-5-3-6-19(13-17)29-23(32)28-18-9-7-16(14-25)8-10-18/h3,5-10,13,21H,4,11-12H2,1-2H3,(H,26,31)(H2,28,29,32) |
| InChIKey | YJUBNEDFNBRZPX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |