C25H25F3N4O2S — CID 42768293
N,N,8-trimethyl-6-[4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 42768293) has the molecular formula C25H25F3N4O2S and a molecular weight of 502.56 g/mol. Its IUPAC name is N,N,8-trimethyl-6-[4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | N,N,8-trimethyl-6-[4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 42768293 |
| Molecular Formula | C25H25F3N4O2S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N,N,8-trimethyl-6-[4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CC1=C(C(=O)N(C)C)C(c2ccc(NC(=O)c3cccc(C(F)(F)F)c3)cc2)N2CCCSC2=N1 |
| InChI | InChI=1S/C25H25F3N4O2S/c1-15-20(23(34)31(2)3)21(32-12-5-13-35-24(32)29-15)16-8-10-19(11-9-16)30-22(33)17-6-4-7-18(14-17)25(26,27)28/h4,6-11,14,21H,5,12-13H2,1-3H3,(H,30,33) |
| InChIKey | GHISUXWYTLIRCF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |